C21H35IN4O5 — CID 111872310
2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[3-(2-methoxyethoxy)propylamino]methylidene]amino]-N-propylacetamide;hydroiodide (PubChem CID 111872310) has the molecular formula C21H35IN4O5 and a molecular weight of 550.44 g/mol. Its IUPAC name is 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[3-(2-methoxyethoxy)propylamino]methylidene]amino]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[3-(2-methoxyethoxy)propylamino]methylidene]amino]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111872310 |
| Molecular Formula | C21H35IN4O5 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[3-(2-methoxyethoxy)propylamino]methylidene]amino]-N-propylacetamide;hydroiodide |
| SMILES | CCCNC(=O)C/N=C(\NCCCOCCOC)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C21H34N4O5.HI/c1-3-8-22-20(26)16-24-21(23-9-4-10-28-14-13-27-2)25-17-6-7-18-19(15-17)30-12-5-11-29-18;/h6-7,15H,3-5,8-14,16H2,1-2H3,(H,22,26)(H2,23,24,25);1H |
| InChIKey | VUJPLYURAKWVNO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|