C22H34N4O5 — CID 111872541
2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[3-(oxolan-2-ylmethoxy)propylamino]methylidene]amino]-N-ethylacetamide (PubChem CID 111872541) has the molecular formula C22H34N4O5 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[3-(oxolan-2-ylmethoxy)propylamino]methylidene]amino]-N-ethylacetamide.
| Compound Name | 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[3-(oxolan-2-ylmethoxy)propylamino]methylidene]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 111872541 |
| Molecular Formula | C22H34N4O5 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[3-(oxolan-2-ylmethoxy)propylamino]methylidene]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)C/N=C(\NCCCOCC1CCCO1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H34N4O5/c1-2-23-21(27)15-25-22(24-9-4-10-28-16-18-6-3-11-29-18)26-17-7-8-19-20(14-17)31-13-5-12-30-19/h7-8,14,18H,2-6,9-13,15-16H2,1H3,(H,23,27)(H2,24,25,26) |
| InChIKey | BHBNHPXWOLETBW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|