C24H40IN3O5 — CID 111872524
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(4-ethoxybutyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111872524) has the molecular formula C24H40IN3O5 and a molecular weight of 577.50 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(4-ethoxybutyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(4-ethoxybutyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111872524 |
| Molecular Formula | C24H40IN3O5 |
| Molecular Weight | 577.50 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(4-ethoxybutyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCOCCCCN/C(=N\CCCOCC1CCCO1)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C24H39N3O5.HI/c1-2-28-13-4-3-11-25-24(26-12-6-14-29-19-21-8-5-15-30-21)27-20-9-10-22-23(18-20)32-17-7-16-31-22;/h9-10,18,21H,2-8,11-17,19H2,1H3,(H2,25,26,27);1H |
| InChIKey | WJIZGKZBNJJNHU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|