C23H37N3O4 — CID 111494794
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(3-methylbutyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111494794) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(3-methylbutyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(3-methylbutyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111494794 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(3-methylbutyl)-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | CC(C)CCN/C(=N\CCCOCC1CCCO1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C23H37N3O4/c1-18(2)9-11-25-23(24-10-4-12-27-17-20-6-3-13-28-20)26-19-7-8-21-22(16-19)30-15-5-14-29-21/h7-8,16,18,20H,3-6,9-15,17H2,1-2H3,(H2,24,25,26) |
| InChIKey | AIOVNDNZGYICLK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|