C21H34IN3O3 — CID 111860595
1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111860595) has the molecular formula C21H34IN3O3 and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111860595 |
| Molecular Formula | C21H34IN3O3 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CC(C)C/N=C(\NCCCOCC1CC1)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C21H33N3O3.HI/c1-16(2)14-23-21(22-9-3-10-25-15-17-5-6-17)24-18-7-8-19-20(13-18)27-12-4-11-26-19;/h7-8,13,16-17H,3-6,9-12,14-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | KBGWCEKEQUGRCA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|