C24H39IN4O4 — CID 111868943
N-butan-2-yl-3-[[N'-[3-(cyclopropylmethoxy)propyl]-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111868943) has the molecular formula C24H39IN4O4 and a molecular weight of 574.50 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N'-[3-(cyclopropylmethoxy)propyl]-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[N'-[3-(cyclopropylmethoxy)propyl]-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111868943 |
| Molecular Formula | C24H39IN4O4 |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | N-butan-2-yl-3-[[N'-[3-(cyclopropylmethoxy)propyl]-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\CCCOCC1CC1)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C24H38N4O4.HI/c1-3-18(2)27-23(29)10-12-26-24(25-11-4-13-30-17-19-6-7-19)28-20-8-9-21-22(16-20)32-15-5-14-31-21;/h8-9,16,18-19H,3-7,10-15,17H2,1-2H3,(H,27,29)(H2,25,26,28);1H |
| InChIKey | GXVWZFMZFRDRSK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|