C25H34IN3O4 — CID 111861198
1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(3-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111861198) has the molecular formula C25H34IN3O4 and a molecular weight of 567.47 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(3-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(3-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111861198 |
| Molecular Formula | C25H34IN3O4 |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(3-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1cccc(C/N=C(\NCCCOCC2CC2)Nc2ccc3c(c2)OCCCO3)c1.I |
| InChI | InChI=1S/C25H33N3O4.HI/c1-29-22-6-2-5-20(15-22)17-27-25(26-11-3-12-30-18-19-7-8-19)28-21-9-10-23-24(16-21)32-14-4-13-31-23;/h2,5-6,9-10,15-16,19H,3-4,7-8,11-14,17-18H2,1H3,(H2,26,27,28);1H |
| InChIKey | AHRXBBKEJRMUIG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|