C24H41IN4O3 — CID 111871416
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(1-ethylpyrrolidin-3-yl)methyl]-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide (PubChem CID 111871416) has the molecular formula C24H41IN4O3 and a molecular weight of 560.52 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(1-ethylpyrrolidin-3-yl)methyl]-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(1-ethylpyrrolidin-3-yl)methyl]-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871416 |
| Molecular Formula | C24H41IN4O3 |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(1-ethylpyrrolidin-3-yl)methyl]-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN1CCC(C/N=C(\NCCCOCC(C)C)Nc2ccc3c(c2)OCCCO3)C1.I |
| InChI | InChI=1S/C24H40N4O3.HI/c1-4-28-11-9-20(17-28)16-26-24(25-10-5-12-29-18-19(2)3)27-21-7-8-22-23(15-21)31-14-6-13-30-22;/h7-8,15,19-20H,4-6,9-14,16-18H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | VVSYXPLFFMTXKP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|