C22H34N6O3 — CID 111871411
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(2-methylpropoxy)propyl]guanidine (PubChem CID 111871411) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(2-methylpropoxy)propyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(2-methylpropoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111871411 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(2-methylpropoxy)propyl]guanidine |
| SMILES | CCn1cnnc1C/N=C(\NCCCOCC(C)C)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H34N6O3/c1-4-28-16-25-27-21(28)14-24-22(23-9-5-10-29-15-17(2)3)26-18-7-8-19-20(13-18)31-12-6-11-30-19/h7-8,13,16-17H,4-6,9-12,14-15H2,1-3H3,(H2,23,24,26) |
| InChIKey | DXJNXUFZCPYPFA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|