C22H36N6O2 — CID 111871277
2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(2-methylpropoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111871277) has the molecular formula C22H36N6O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(2-methylpropoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(2-methylpropoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111871277 |
| Molecular Formula | C22H36N6O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(2-methylpropoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CCn1cnnc1C/N=C(\NCCCOCC(C)C)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C22H36N6O2/c1-6-28-16-25-27-21(28)14-24-22(23-12-7-13-29-15-17(2)3)26-19-8-10-20(11-9-19)30-18(4)5/h8-11,16-18H,6-7,12-15H2,1-5H3,(H2,23,24,26) |
| InChIKey | UUWYTOKJVVIFFP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|