C21H30IN3O4 — CID 111860921
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111860921) has the molecular formula C21H30IN3O4 and a molecular weight of 515.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111860921 |
| Molecular Formula | C21H30IN3O4 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C21H29N3O4.HI/c1-2-25-12-4-10-22-21(23-11-9-18-6-3-13-26-18)24-17-7-8-19-20(16-17)28-15-5-14-27-19;/h3,6-8,13,16H,2,4-5,9-12,14-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | HNINTWZIRJSEFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|