C24H26N4O4 — CID 111862138
2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]-N-phenylacetamide (PubChem CID 111862138) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]-N-phenylacetamide.
| Compound Name | 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 111862138 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]-N-phenylacetamide |
| SMILES | O=C(C/N=C(\NCCc1ccco1)Nc1ccc2c(c1)OCCCO2)Nc1ccccc1 |
| InChI | InChI=1S/C24H26N4O4/c29-23(27-18-6-2-1-3-7-18)17-26-24(25-12-11-20-8-4-13-30-20)28-19-9-10-21-22(16-19)32-15-5-14-31-21/h1-4,6-10,13,16H,5,11-12,14-15,17H2,(H,27,29)(H2,25,26,28) |
| InChIKey | ZQNVVODVPBCNFN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|