C24H25N3O5 — CID 111491398
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(furan-2-ylmethyl)guanidine (PubChem CID 111491398) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(furan-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(furan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111491398 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(furan-2-ylmethyl)guanidine |
| SMILES | c1coc(C/N=C(\NCCc2ccc3c(c2)OCO3)Nc2ccc3c(c2)OCCCO3)c1 |
| InChI | InChI=1S/C24H25N3O5/c1-3-19(28-10-1)15-26-24(25-9-8-17-4-6-21-22(13-17)32-16-31-21)27-18-5-7-20-23(14-18)30-12-2-11-29-20/h1,3-7,10,13-14H,2,8-9,11-12,15-16H2,(H2,25,26,27) |
| InChIKey | PTHWUAAKETUNSM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|