C23H32N4O4 — CID 111860298
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(furan-2-yl)ethyl]-2-(2-morpholin-4-ylpropyl)guanidine (PubChem CID 111860298) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(furan-2-yl)ethyl]-2-(2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(furan-2-yl)ethyl]-2-(2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111860298 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(furan-2-yl)ethyl]-2-(2-morpholin-4-ylpropyl)guanidine |
| SMILES | CC(C/N=C(\NCCc1ccco1)Nc1ccc2c(c1)OCCCO2)N1CCOCC1 |
| InChI | InChI=1S/C23H32N4O4/c1-18(27-9-14-28-15-10-27)17-25-23(24-8-7-20-4-2-11-29-20)26-19-5-6-21-22(16-19)31-13-3-12-30-21/h2,4-6,11,16,18H,3,7-10,12-15,17H2,1H3,(H2,24,25,26) |
| InChIKey | VPDMZHVITJSFML-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|