C23H28FIN4O3 — CID 111862770
N-cyclopropyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[2-(2-fluorophenyl)ethylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111862770) has the molecular formula C23H28FIN4O3 and a molecular weight of 554.40 g/mol. Its IUPAC name is N-cyclopropyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[2-(2-fluorophenyl)ethylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[2-(2-fluorophenyl)ethylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111862770 |
| Molecular Formula | C23H28FIN4O3 |
| Molecular Weight | 554.40 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | N-cyclopropyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[2-(2-fluorophenyl)ethylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | I.O=C(C/N=C(\NCCc1ccccc1F)Nc1ccc2c(c1)OCCCO2)NC1CC1 |
| InChI | InChI=1S/C23H27FN4O3.HI/c24-19-5-2-1-4-16(19)10-11-25-23(26-15-22(29)27-17-6-7-17)28-18-8-9-20-21(14-18)31-13-3-12-30-20;/h1-2,4-5,8-9,14,17H,3,6-7,10-13,15H2,(H,27,29)(H2,25,26,28);1H |
| InChIKey | RAAISPYKDJWMCI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|