C23H26FN5O2 — CID 111862751
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-fluorophenyl)ethyl]-3-(2-pyrazol-1-ylethyl)guanidine (PubChem CID 111862751) has the molecular formula C23H26FN5O2 and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-fluorophenyl)ethyl]-3-(2-pyrazol-1-ylethyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-fluorophenyl)ethyl]-3-(2-pyrazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111862751 |
| Molecular Formula | C23H26FN5O2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-fluorophenyl)ethyl]-3-(2-pyrazol-1-ylethyl)guanidine |
| SMILES | Fc1ccccc1CC/N=C(\NCCn1cccn1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C23H26FN5O2/c24-20-6-2-1-5-18(20)9-11-25-23(26-12-14-29-13-3-10-27-29)28-19-7-8-21-22(17-19)31-16-4-15-30-21/h1-3,5-8,10,13,17H,4,9,11-12,14-16H2,(H2,25,26,28) |
| InChIKey | HILZHBHJVXVKJK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|