C24H33FIN3O3 — CID 111862798
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-fluorophenyl)ethyl]-2-(5-methoxypentyl)guanidine;hydroiodide (PubChem CID 111862798) has the molecular formula C24H33FIN3O3 and a molecular weight of 557.45 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-fluorophenyl)ethyl]-2-(5-methoxypentyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-fluorophenyl)ethyl]-2-(5-methoxypentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111862798 |
| Molecular Formula | C24H33FIN3O3 |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-fluorophenyl)ethyl]-2-(5-methoxypentyl)guanidine;hydroiodide |
| SMILES | COCCCCC/N=C(\NCCc1ccccc1F)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C24H32FN3O3.HI/c1-29-15-6-2-5-13-26-24(27-14-12-19-8-3-4-9-21(19)25)28-20-10-11-22-23(18-20)31-17-7-16-30-22;/h3-4,8-11,18H,2,5-7,12-17H2,1H3,(H2,26,27,28);1H |
| InChIKey | LKNHDCCGTJGJBG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|