C21H30IN3O4S — CID 111861636
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-methoxyethoxy)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111861636) has the molecular formula C21H30IN3O4S and a molecular weight of 547.46 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-methoxyethoxy)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-methoxyethoxy)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111861636 |
| Molecular Formula | C21H30IN3O4S |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-methoxyethoxy)ethyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | COCCOCC/N=C(\NCCc1cccs1)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C21H29N3O4S.HI/c1-25-13-14-26-12-9-23-21(22-8-7-18-4-2-15-29-18)24-17-5-6-19-20(16-17)28-11-3-10-27-19;/h2,4-6,15-16H,3,7-14H2,1H3,(H2,22,23,24);1H |
| InChIKey | ZKCQKTDFLPFGRJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|