C22H26N4O2S2 — CID 111861591
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111861591) has the molecular formula C22H26N4O2S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111861591 |
| Molecular Formula | C22H26N4O2S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine |
| SMILES | Cc1nc(CCN/C(=N\CCc2cccs2)Nc2ccc3c(c2)OCCCO3)cs1 |
| InChI | InChI=1S/C22H26N4O2S2/c1-16-25-18(15-30-16)7-9-23-22(24-10-8-19-4-2-13-29-19)26-17-5-6-20-21(14-17)28-12-3-11-27-20/h2,4-6,13-15H,3,7-12H2,1H3,(H2,23,24,26) |
| InChIKey | ZKDWRYIPQIBEID-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|