C20H24N6O2S — CID 111861603
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111861603) has the molecular formula C20H24N6O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111861603 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | Cn1cnnc1C/N=C(\NCCc1cccs1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H24N6O2S/c1-26-14-23-25-19(26)13-22-20(21-8-7-16-4-2-11-29-16)24-15-5-6-17-18(12-15)28-10-3-9-27-17/h2,4-6,11-12,14H,3,7-10,13H2,1H3,(H2,21,22,24) |
| InChIKey | YHJPCHIPFDCIMQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|