C23H27IN4O3S — CID 111861654
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(6-methoxy-3-pyridinyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111861654) has the molecular formula C23H27IN4O3S and a molecular weight of 566.47 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(6-methoxy-3-pyridinyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(6-methoxy-3-pyridinyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111861654 |
| Molecular Formula | C23H27IN4O3S |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(6-methoxy-3-pyridinyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\NCCc2cccs2)Nc2ccc3c(c2)OCCCO3)cn1.I |
| InChI | InChI=1S/C23H26N4O3S.HI/c1-28-22-8-5-17(15-25-22)16-26-23(24-10-9-19-4-2-13-31-19)27-18-6-7-20-21(14-18)30-12-3-11-29-20;/h2,4-8,13-15H,3,9-12,16H2,1H3,(H2,24,26,27);1H |
| InChIKey | PUCGYMUFBNIQGK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|