C23H31N3O5 — CID 111860930
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-propyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111860930) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-propyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-propyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111860930 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-propyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C23H31N3O5/c1-5-9-24-23(26-17-7-8-18-19(14-17)31-11-6-10-30-18)25-15-16-12-20(27-2)22(29-4)21(13-16)28-3/h7-8,12-14H,5-6,9-11,15H2,1-4H3,(H2,24,25,26) |
| InChIKey | VNTSIZOMSAHUBD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|