C19H25N3O4S2 — CID 111861748
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylsulfonylethyl)-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111861748) has the molecular formula C19H25N3O4S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylsulfonylethyl)-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylsulfonylethyl)-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111861748 |
| Molecular Formula | C19H25N3O4S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylsulfonylethyl)-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CS(=O)(=O)CC/N=C(\NCCc1cccs1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H25N3O4S2/c1-28(23,24)13-9-21-19(20-8-7-16-4-2-12-27-16)22-15-5-6-17-18(14-15)26-11-3-10-25-17/h2,4-6,12,14H,3,7-11,13H2,1H3,(H2,20,21,22) |
| InChIKey | HUZMBGUMBGIDHP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|