C21H27N3O4S2 — CID 111865456
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylsulfonylethyl)-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111865456) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylsulfonylethyl)-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylsulfonylethyl)-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111865456 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-methylsulfonylethyl)-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | CS(=O)(=O)CC/N=C(\NCCSc1ccccc1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H27N3O4S2/c1-30(25,26)15-11-23-21(22-10-14-29-18-6-3-2-4-7-18)24-17-8-9-19-20(16-17)28-13-5-12-27-19/h2-4,6-9,16H,5,10-15H2,1H3,(H2,22,23,24) |
| InChIKey | CLSLZXHENUDWTG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|