C18H22IN3O3 — CID 119117096
2-(1,3-benzodioxol-5-ylmethyl)-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 119117096) has the molecular formula C18H22IN3O3 and a molecular weight of 455.30 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119117096 |
| Molecular Formula | C18H22IN3O3 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CC(C)Oc1ccc(N/C(N)=N/Cc2ccc3c(c2)OCO3)cc1.I |
| InChI | InChI=1S/C18H21N3O3.HI/c1-12(2)24-15-6-4-14(5-7-15)21-18(19)20-10-13-3-8-16-17(9-13)23-11-22-16;/h3-9,12H,10-11H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | GIKXEPLCZLNCFX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|