C24H39IN4O4 — CID 111870830
3-[[(3-cyclohexyloxypropylamino)-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111870830) has the molecular formula C24H39IN4O4 and a molecular weight of 574.50 g/mol. Its IUPAC name is 3-[[(3-cyclohexyloxypropylamino)-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[(3-cyclohexyloxypropylamino)-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111870830 |
| Molecular Formula | C24H39IN4O4 |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 3-[[(3-cyclohexyloxypropylamino)-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CC(C)(C/N=C(\NCCCOC1CCCCC1)Nc1ccc2c(c1)OCCCO2)C(N)=O.I |
| InChI | InChI=1S/C24H38N4O4.HI/c1-24(2,22(25)29)17-27-23(26-12-6-13-30-19-8-4-3-5-9-19)28-18-10-11-20-21(16-18)32-15-7-14-31-20;/h10-11,16,19H,3-9,12-15,17H2,1-2H3,(H2,25,29)(H2,26,27,28);1H |
| InChIKey | HYIZOQGNPTWFSX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|