C24H35N3O5 — CID 111494538
1-(3-methoxypropyl)-3-(4-propan-2-yloxyphenyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111494538) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(4-propan-2-yloxyphenyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-(3-methoxypropyl)-3-(4-propan-2-yloxyphenyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111494538 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(4-propan-2-yloxyphenyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | COCCCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C24H35N3O5/c1-17(2)32-20-10-8-19(9-11-20)27-24(25-12-7-13-28-3)26-16-18-14-21(29-4)23(31-6)22(15-18)30-5/h8-11,14-15,17H,7,12-13,16H2,1-6H3,(H2,25,26,27) |
| InChIKey | XXODOLZKHPIVOM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|