C24H31N5O3 — CID 111875539
1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(3-phenoxypropyl)-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111875539) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(3-phenoxypropyl)-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(3-phenoxypropyl)-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111875539 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(3-phenoxypropyl)-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | Cc1noc(CCN/C(=N\CCCOc2ccccc2)Nc2ccc(OC(C)C)cc2)n1 |
| InChI | InChI=1S/C24H31N5O3/c1-18(2)31-22-12-10-20(11-13-22)28-24(26-16-14-23-27-19(3)29-32-23)25-15-7-17-30-21-8-5-4-6-9-21/h4-6,8-13,18H,7,14-17H2,1-3H3,(H2,25,26,28) |
| InChIKey | JVCSFVFAWODRRP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|