C20H30N6O3 — CID 111866824
N-tert-butyl-2-[[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide (PubChem CID 111866824) has the molecular formula C20H30N6O3 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-tert-butyl-2-[[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111866824 |
| Molecular Formula | C20H30N6O3 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N-tert-butyl-2-[[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide |
| SMILES | Cc1noc(CN/C(=N\CC(=O)NC(C)(C)C)Nc2ccc(OC(C)C)cc2)n1 |
| InChI | InChI=1S/C20H30N6O3/c1-13(2)28-16-9-7-15(8-10-16)24-19(21-11-17(27)25-20(4,5)6)22-12-18-23-14(3)26-29-18/h7-10,13H,11-12H2,1-6H3,(H,25,27)(H2,21,22,24) |
| InChIKey | RYQGQMGVOFXTAU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|