C24H40N4O4 — CID 111866964
methyl 7-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]heptanoate (PubChem CID 111866964) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is methyl 7-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]heptanoate.
| Compound Name | methyl 7-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111866964 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | methyl 7-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]heptanoate |
| SMILES | COC(=O)CCCCCCN/C(=N\CC(=O)NC(C)(C)C)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C24H40N4O4/c1-18(2)32-20-14-12-19(13-15-20)27-23(26-17-21(29)28-24(3,4)5)25-16-10-8-7-9-11-22(30)31-6/h12-15,18H,7-11,16-17H2,1-6H3,(H,28,29)(H2,25,26,27) |
| InChIKey | KPYBJUZUASGUAI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|