C23H37IN6O2 — CID 111866901
N-tert-butyl-2-[[[3-(5-methyl-1H-pyrazol-4-yl)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111866901) has the molecular formula C23H37IN6O2 and a molecular weight of 556.49 g/mol. Its IUPAC name is N-tert-butyl-2-[[[3-(5-methyl-1H-pyrazol-4-yl)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[[3-(5-methyl-1H-pyrazol-4-yl)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111866901 |
| Molecular Formula | C23H37IN6O2 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | N-tert-butyl-2-[[[3-(5-methyl-1H-pyrazol-4-yl)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide;hydroiodide |
| SMILES | Cc1[nH]ncc1CCCN/C(=N\CC(=O)NC(C)(C)C)Nc1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C23H36N6O2.HI/c1-16(2)31-20-11-9-19(10-12-20)27-22(25-15-21(30)28-23(4,5)6)24-13-7-8-18-14-26-29-17(18)3;/h9-12,14,16H,7-8,13,15H2,1-6H3,(H,26,29)(H,28,30)(H2,24,25,27);1H |
| InChIKey | KLZXPNXRDGOQIR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|