C22H32N4O2S — CID 111866726
N-tert-butyl-2-[[[(3-methylthiophen-2-yl)methylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide (PubChem CID 111866726) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-tert-butyl-2-[[[(3-methylthiophen-2-yl)methylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[[(3-methylthiophen-2-yl)methylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111866726 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-tert-butyl-2-[[[(3-methylthiophen-2-yl)methylamino]-(4-propan-2-yloxyanilino)methylidene]amino]acetamide |
| SMILES | Cc1ccsc1CN/C(=N\CC(=O)NC(C)(C)C)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C22H32N4O2S/c1-15(2)28-18-9-7-17(8-10-18)25-21(23-13-19-16(3)11-12-29-19)24-14-20(27)26-22(4,5)6/h7-12,15H,13-14H2,1-6H3,(H,26,27)(H2,23,24,25) |
| InChIKey | HTFOVYHJHVLADK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|