C22H27N5O2S — CID 111865444
2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(2-phenylsulfanylethyl)-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111865444) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(2-phenylsulfanylethyl)-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(2-phenylsulfanylethyl)-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111865444 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-1-(2-phenylsulfanylethyl)-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | Cc1noc(C/N=C(\NCCSc2ccccc2)Nc2ccc(OC(C)C)cc2)n1 |
| InChI | InChI=1S/C22H27N5O2S/c1-16(2)28-19-11-9-18(10-12-19)26-22(24-15-21-25-17(3)27-29-21)23-13-14-30-20-7-5-4-6-8-20/h4-12,16H,13-15H2,1-3H3,(H2,23,24,26) |
| InChIKey | UNVSCEBHFVSDIK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|