C25H41N5O2 — CID 111867140
N-[2-[[N'-[3-(4-methylpiperidin-1-yl)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111867140) has the molecular formula C25H41N5O2 and a molecular weight of 443.64 g/mol. Its IUPAC name is N-[2-[[N'-[3-(4-methylpiperidin-1-yl)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N'-[3-(4-methylpiperidin-1-yl)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111867140 |
| Molecular Formula | C25H41N5O2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | N-[2-[[N'-[3-(4-methylpiperidin-1-yl)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CC1CCN(CCC/N=C(\NCCNC(=O)C2CC2)Nc2ccc(OC(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H41N5O2/c1-19(2)32-23-9-7-22(8-10-23)29-25(28-15-14-26-24(31)21-5-6-21)27-13-4-16-30-17-11-20(3)12-18-30/h7-10,19-21H,4-6,11-18H2,1-3H3,(H,26,31)(H2,27,28,29) |
| InChIKey | LARBFBUEGWROIM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|