C22H36N4O4 — CID 111871777
N-[2-[[N'-[3-(2-methoxyethoxy)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111871777) has the molecular formula C22H36N4O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-[2-[[N'-[3-(2-methoxyethoxy)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N'-[3-(2-methoxyethoxy)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111871777 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | N-[2-[[N'-[3-(2-methoxyethoxy)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | COCCOCCC/N=C(\NCCNC(=O)C1CC1)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C22H36N4O4/c1-17(2)30-20-9-7-19(8-10-20)26-22(24-11-4-14-29-16-15-28-3)25-13-12-23-21(27)18-5-6-18/h7-10,17-18H,4-6,11-16H2,1-3H3,(H,23,27)(H2,24,25,26) |
| InChIKey | JIAZWGAWTGANRZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|