C16H21F3N6 — CID 111295505
1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111295505) has the molecular formula C16H21F3N6 and a molecular weight of 354.38 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111295505 |
| Molecular Formula | C16H21F3N6 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1C)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3N6/c1-3-20-15(22-10-14-24-23-11-25(14)2)21-9-8-12-4-6-13(7-5-12)16(17,18)19/h4-7,11H,3,8-10H2,1-2H3,(H2,20,21,22) |
| InChIKey | BFHQVPHZDLGJQI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|