C19H31IN6 — CID 109465037
1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109465037) has the molecular formula C19H31IN6 and a molecular weight of 470.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109465037 |
| Molecular Formula | C19H31IN6 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1C)NCC(C)(C)c1ccc(CC)cc1.I |
| InChI | InChI=1S/C19H30N6.HI/c1-6-15-8-10-16(11-9-15)19(3,4)13-22-18(20-7-2)21-12-17-24-23-14-25(17)5;/h8-11,14H,6-7,12-13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | JGCLUSUREQLUPL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|