C20H32N6 — CID 109464916
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]guanidine (PubChem CID 109464916) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]guanidine |
|---|---|
| PubChem CID | 109464916 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]guanidine |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)NCC(C)(C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C20H32N6/c1-7-16-9-11-17(12-10-16)20(4,5)14-23-19(21-8-2)22-13-18-25-24-15(3)26(18)6/h9-12H,7-8,13-14H2,1-6H3,(H2,21,22,23) |
| InChIKey | SBWQGOGOZDLHLX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|