C18H25F3N6O — CID 111857693
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111857693) has the molecular formula C18H25F3N6O and a molecular weight of 398.43 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111857693 |
| Molecular Formula | C18H25F3N6O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCc1nnc(C)n1C |
| InChI | InChI=1S/C18H25F3N6O/c1-4-22-17(24-10-16-26-25-13(2)27(16)3)23-9-14-5-7-15(8-6-14)11-28-12-18(19,20)21/h5-8H,4,9-12H2,1-3H3,(H2,22,23,24) |
| InChIKey | UIJHBKLXNBCCFV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|