C15H25IN6S — CID 111673441
1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111673441) has the molecular formula C15H25IN6S and a molecular weight of 448.38 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111673441 |
| Molecular Formula | C15H25IN6S |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1C)NCC(C)Cc1cccs1.I |
| InChI | InChI=1S/C15H24N6S.HI/c1-4-16-15(18-10-14-20-19-11-21(14)3)17-9-12(2)8-13-6-5-7-22-13;/h5-7,11-12H,4,8-10H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | HVGOVLFOGFJKAP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|