C18H29IN6S — CID 111637111
1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-thiophen-2-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 111637111) has the molecular formula C18H29IN6S and a molecular weight of 488.44 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-thiophen-2-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-thiophen-2-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111637111 |
| Molecular Formula | C18H29IN6S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[(1-thiophen-2-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1C)NCC1(c2cccs2)CCCCC1.I |
| InChI | InChI=1S/C18H28N6S.HI/c1-3-19-17(20-12-16-23-22-14-24(16)2)21-13-18(9-5-4-6-10-18)15-8-7-11-25-15;/h7-8,11,14H,3-6,9-10,12-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | ZYIRZNGLFTWDRA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|