C16H20IN7S — CID 75369595
1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(pyridin-2-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 75369595) has the molecular formula C16H20IN7S and a molecular weight of 469.36 g/mol. Its IUPAC name is 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(pyridin-2-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(pyridin-2-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 75369595 |
| Molecular Formula | C16H20IN7S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(pyridin-2-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | Cn1cnnc1CN/C(=N/Cc1ccccn1)NCc1cccs1.I |
| InChI | InChI=1S/C16H19N7S.HI/c1-23-12-21-22-15(23)11-20-16(19-10-14-6-4-8-24-14)18-9-13-5-2-3-7-17-13;/h2-8,12H,9-11H2,1H3,(H2,18,19,20);1H |
| InChIKey | PDQWQEGBNRYONA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|