C21H27IN6OS — CID 111555924
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111555924) has the molecular formula C21H27IN6OS and a molecular weight of 538.46 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111555924 |
| Molecular Formula | C21H27IN6OS |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C=CCOc1ccccc1C/N=C(\NCc1cccs1)NCc1nnc(C)n1C.I |
| InChI | InChI=1S/C21H26N6OS.HI/c1-4-11-28-19-10-6-5-8-17(19)13-22-21(23-14-18-9-7-12-29-18)24-15-20-26-25-16(2)27(20)3;/h4-10,12H,1,11,13-15H2,2-3H3,(H2,22,23,24);1H |
| InChIKey | MRIHMEDPZCTVBG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|