C25H31IN6O2 — CID 111983424
1-(3,4-dihydro-2H-chromen-4-yl)-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111983424) has the molecular formula C25H31IN6O2 and a molecular weight of 574.47 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111983424 |
| Molecular Formula | C25H31IN6O2 |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C=CCOc1ccccc1C/N=C(\NCc1nnc(C)n1C)NC1CCOc2ccccc21.I |
| InChI | InChI=1S/C25H30N6O2.HI/c1-4-14-32-22-11-7-5-9-19(22)16-26-25(27-17-24-30-29-18(2)31(24)3)28-21-13-15-33-23-12-8-6-10-20(21)23;/h4-12,21H,1,13-17H2,2-3H3,(H2,26,27,28);1H |
| InChIKey | HHUZGUXVQQECPF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|