C24H28IN3O3 — CID 111906796
1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111906796) has the molecular formula C24H28IN3O3 and a molecular weight of 533.41 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111906796 |
| Molecular Formula | C24H28IN3O3 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-[(2-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccccc1C/N=C(\NCCc1ccco1)NC1CCOc2ccccc21.I |
| InChI | InChI=1S/C24H27N3O3.HI/c1-28-22-10-4-2-7-18(22)17-26-24(25-14-12-19-8-6-15-29-19)27-21-13-16-30-23-11-5-3-9-20(21)23;/h2-11,15,21H,12-14,16-17H2,1H3,(H2,25,26,27);1H |
| InChIKey | RLCBODGKRWPSGJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|