C25H29N3O4 — CID 111903627
1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3,4-dimethoxyphenyl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 111903627) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3,4-dimethoxyphenyl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3,4-dimethoxyphenyl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111903627 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3,4-dimethoxyphenyl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | COc1ccc(C/N=C(\NCCc2ccco2)NC2CCOc3ccccc32)cc1OC |
| InChI | InChI=1S/C25H29N3O4/c1-29-23-10-9-18(16-24(23)30-2)17-27-25(26-13-11-19-6-5-14-31-19)28-21-12-15-32-22-8-4-3-7-20(21)22/h3-10,14,16,21H,11-13,15,17H2,1-2H3,(H2,26,27,28) |
| InChIKey | WHTGIPNJKJVVQS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|