C21H27N3O3 — CID 111542170
1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine (PubChem CID 111542170) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111542170 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine |
| SMILES | c1coc(CCN/C(=N\CC2CCCO2)NC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C21H27N3O3/c1-2-8-20-18(7-1)19(10-14-27-20)24-21(23-15-17-6-4-13-26-17)22-11-9-16-5-3-12-25-16/h1-3,5,7-8,12,17,19H,4,6,9-11,13-15H2,(H2,22,23,24) |
| InChIKey | AZJMSKXOPWBYGQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|