C25H33N5O2 — CID 110050624
1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]guanidine (PubChem CID 110050624) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 110050624 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-[2-(furan-2-yl)ethyl]-2-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]guanidine |
| SMILES | Cc1nn(C)c(C)c1CCC/N=C(\NCCc1ccco1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C25H33N5O2/c1-18-21(19(2)30(3)29-18)10-6-14-26-25(27-15-12-20-8-7-16-31-20)28-23-13-17-32-24-11-5-4-9-22(23)24/h4-5,7-9,11,16,23H,6,10,12-15,17H2,1-3H3,(H2,26,27,28) |
| InChIKey | GTIFLRGMQJXDMC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|