C24H31IN6O2 — CID 111906986
1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide (PubChem CID 111906986) has the molecular formula C24H31IN6O2 and a molecular weight of 562.46 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111906986 |
| Molecular Formula | C24H31IN6O2 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(OCCN/C(=N\Cc2nnc(C)n2C)NC2CCOc3ccccc32)cc1.I |
| InChI | InChI=1S/C24H30N6O2.HI/c1-17-8-10-19(11-9-17)31-15-13-25-24(26-16-23-29-28-18(2)30(23)3)27-21-12-14-32-22-7-5-4-6-20(21)22;/h4-11,21H,12-16H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | WYBCOLJVPLFWNM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|