C22H25ClN6O — CID 111892225
2-[(4-chlorophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111892225) has the molecular formula C22H25ClN6O and a molecular weight of 424.94 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111892225 |
| Molecular Formula | C22H25ClN6O |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | Cc1nnc(CN/C(=N\Cc2ccc(Cl)cc2)NC2CCOc3ccccc32)n1C |
| InChI | InChI=1S/C22H25ClN6O/c1-15-27-28-21(29(15)2)14-25-22(24-13-16-7-9-17(23)10-8-16)26-19-11-12-30-20-6-4-3-5-18(19)20/h3-10,19H,11-14H2,1-2H3,(H2,24,25,26) |
| InChIKey | OXODVWGGICYANG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|